C9H11N4O4+ — CID 71304748
2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetic acid (PubChem CID 71304748) has the molecular formula C9H11N4O4+ and a molecular weight of 239.21 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetic acid.
| Compound Name | 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetic acid |
|---|---|
| PubChem CID | 71304748 |
| Molecular Formula | C9H11N4O4+ |
| Molecular Weight | 239.21 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetic acid |
| SMILES | CN1C(=O)C2C(=NC=[N+]2CC(=O)O)N(C)C1=O |
| InChI | InChI=1S/C9H10N4O4/c1-11-7-6(8(16)12(2)9(11)17)13(4-10-7)3-5(14)15/h4,6H,3H2,1-2H3/p+1 |
| InChIKey | AXXXKDAFWZFXKF-UHFFFAOYSA-O |
| XLogP | -1.58 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.21 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|