2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetic acid

C9H11N4O4+ — CID 71304748

IUPAC2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetic acid
SMILESCN1C(=O)C2C(=NC=[N+]2CC(=O)O)N(C)C1=O
InChIInChI=1S/C9H10N4O4/c1-11-7-6(8(16)12(2)9(11)17)13(4-10-7)3-5(14)15/h4,6H,3H2,1-2H3/p+1
InChIKeyAXXXKDAFWZFXKF-UHFFFAOYSA-O
MW239.21 g/mol
LogP-1.58
Rot. Bonds2

About 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetic acid

2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetic acid (PubChem CID 71304748) has the molecular formula C9H11N4O4+ and a molecular weight of 239.21 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetic acid.

Molecular Properties

Compound Name2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetic acid
PubChem CID71304748
Molecular FormulaC9H11N4O4+
Molecular Weight239.21 g/mol
Exact Mass239.08
IUPAC Name2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetic acid
SMILESCN1C(=O)C2C(=NC=[N+]2CC(=O)O)N(C)C1=O
InChIInChI=1S/C9H10N4O4/c1-11-7-6(8(16)12(2)9(11)17)13(4-10-7)3-5(14)15/h4,6H,3H2,1-2H3/p+1
InChIKeyAXXXKDAFWZFXKF-UHFFFAOYSA-O
XLogP-1.58
TPSA93.29 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.21
LogP ≤ 5-1.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}

Analyze 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetic acid?
The IUPAC name of 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetic acid (CID 71304748) is 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetic acid.
What is the SMILES notation for 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetic acid?
The canonical SMILES for 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetic acid is CN1C(=O)C2C(=NC=[N+]2CC(=O)O)N(C)C1=O.
What is the InChIKey of 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetic acid?
The InChIKey is AXXXKDAFWZFXKF-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H10N4O4/c1-11-7-6(8(16)12(2)9(11)17)13(4-10-7)3-5(14)15/h4,6H,3H2,1-2H3/p+1.
What are the key properties of 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetic acid?
2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetic acid has a molecular weight of 239.21 g/mol, XLogP of -1.58, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dimethyl-2,6-dioxo-5H-purin-7-ium-7-yl)acetic acid is sourced from PubChem (CID 71304748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).