2-(4-methoxy-3,7-dimethyl-2,6-dioxo-5H-purin-1-yl)acetic acid

C10H14N4O5 — CID 153407590

IUPAC2-(4-methoxy-3,7-dimethyl-2,6-dioxo-5H-purin-1-yl)acetic acid
SMILESCOC12N=CN(C)C1C(=O)N(CC(=O)O)C(=O)N2C
InChIInChI=1S/C10H14N4O5/c1-12-5-11-10(19-3)7(12)8(17)14(4-6(15)16)9(18)13(10)2/h5,7H,4H2,1-3H3,(H,15,16)
InChIKeyQVDJDZWQEMMQME-UHFFFAOYSA-N
MW270.25 g/mol
LogP-1.39
Rot. Bonds3

About 2-(4-methoxy-3,7-dimethyl-2,6-dioxo-5H-purin-1-yl)acetic acid

2-(4-methoxy-3,7-dimethyl-2,6-dioxo-5H-purin-1-yl)acetic acid (PubChem CID 153407590) has the molecular formula C10H14N4O5 and a molecular weight of 270.25 g/mol. Its IUPAC name is 2-(4-methoxy-3,7-dimethyl-2,6-dioxo-5H-purin-1-yl)acetic acid.

Molecular Properties

Compound Name2-(4-methoxy-3,7-dimethyl-2,6-dioxo-5H-purin-1-yl)acetic acid
PubChem CID153407590
Molecular FormulaC10H14N4O5
Molecular Weight270.25 g/mol
Exact Mass270.10
IUPAC Name2-(4-methoxy-3,7-dimethyl-2,6-dioxo-5H-purin-1-yl)acetic acid
SMILESCOC12N=CN(C)C1C(=O)N(CC(=O)O)C(=O)N2C
InChIInChI=1S/C10H14N4O5/c1-12-5-11-10(19-3)7(12)8(17)14(4-6(15)16)9(18)13(10)2/h5,7H,4H2,1-3H3,(H,15,16)
InChIKeyQVDJDZWQEMMQME-UHFFFAOYSA-N
XLogP-1.39
TPSA102.75 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500270.25
LogP ≤ 5-1.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze 2-(4-methoxy-3,7-dimethyl-2,6-dioxo-5H-purin-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-methoxy-3,7-dimethyl-2,6-dioxo-5H-purin-1-yl)acetic acid?
The IUPAC name of 2-(4-methoxy-3,7-dimethyl-2,6-dioxo-5H-purin-1-yl)acetic acid (CID 153407590) is 2-(4-methoxy-3,7-dimethyl-2,6-dioxo-5H-purin-1-yl)acetic acid.
What is the SMILES notation for 2-(4-methoxy-3,7-dimethyl-2,6-dioxo-5H-purin-1-yl)acetic acid?
The canonical SMILES for 2-(4-methoxy-3,7-dimethyl-2,6-dioxo-5H-purin-1-yl)acetic acid is COC12N=CN(C)C1C(=O)N(CC(=O)O)C(=O)N2C.
What is the InChIKey of 2-(4-methoxy-3,7-dimethyl-2,6-dioxo-5H-purin-1-yl)acetic acid?
The InChIKey is QVDJDZWQEMMQME-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O5/c1-12-5-11-10(19-3)7(12)8(17)14(4-6(15)16)9(18)13(10)2/h5,7H,4H2,1-3H3,(H,15,16).
What are the key properties of 2-(4-methoxy-3,7-dimethyl-2,6-dioxo-5H-purin-1-yl)acetic acid?
2-(4-methoxy-3,7-dimethyl-2,6-dioxo-5H-purin-1-yl)acetic acid has a molecular weight of 270.25 g/mol, XLogP of -1.39, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxy-3,7-dimethyl-2,6-dioxo-5H-purin-1-yl)acetic acid is sourced from PubChem (CID 153407590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).