C10H14N4O5 — CID 153407590
2-(4-methoxy-3,7-dimethyl-2,6-dioxo-5H-purin-1-yl)acetic acid (PubChem CID 153407590) has the molecular formula C10H14N4O5 and a molecular weight of 270.25 g/mol. Its IUPAC name is 2-(4-methoxy-3,7-dimethyl-2,6-dioxo-5H-purin-1-yl)acetic acid.
| Compound Name | 2-(4-methoxy-3,7-dimethyl-2,6-dioxo-5H-purin-1-yl)acetic acid |
|---|---|
| PubChem CID | 153407590 |
| Molecular Formula | C10H14N4O5 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-(4-methoxy-3,7-dimethyl-2,6-dioxo-5H-purin-1-yl)acetic acid |
| SMILES | COC12N=CN(C)C1C(=O)N(CC(=O)O)C(=O)N2C |
| InChI | InChI=1S/C10H14N4O5/c1-12-5-11-10(19-3)7(12)8(17)14(4-6(15)16)9(18)13(10)2/h5,7H,4H2,1-3H3,(H,15,16) |
| InChIKey | QVDJDZWQEMMQME-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 102.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |