C10H14N4O4 — CID 155600045
2-(3,4,7-trimethyl-2,6-dioxo-5H-purin-1-yl)acetic acid (PubChem CID 155600045) has the molecular formula C10H14N4O4 and a molecular weight of 254.25 g/mol. Its IUPAC name is 2-(3,4,7-trimethyl-2,6-dioxo-5H-purin-1-yl)acetic acid.
| Compound Name | 2-(3,4,7-trimethyl-2,6-dioxo-5H-purin-1-yl)acetic acid |
|---|---|
| PubChem CID | 155600045 |
| Molecular Formula | C10H14N4O4 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 2-(3,4,7-trimethyl-2,6-dioxo-5H-purin-1-yl)acetic acid |
| SMILES | CN1C=NC2(C)C1C(=O)N(CC(=O)O)C(=O)N2C |
| InChI | InChI=1S/C10H14N4O4/c1-10-7(12(2)5-11-10)8(17)14(4-6(15)16)9(18)13(10)3/h5,7H,4H2,1-3H3,(H,15,16) |
| InChIKey | MEDWJSXSZHXQQS-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 93.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |