C15H24N5O4+ — CID 123463439
2-(11,13,13-trimethyl-7,15-dioxo-1,3,5,8-tetraza-13-azoniatricyclo[6.6.1.02,6]pentadec-3-en-5-yl)acetic acid (PubChem CID 123463439) has the molecular formula C15H24N5O4+ and a molecular weight of 338.39 g/mol. Its IUPAC name is 2-(11,13,13-trimethyl-7,15-dioxo-1,3,5,8-tetraza-13-azoniatricyclo[6.6.1.02,6]pentadec-3-en-5-yl)acetic acid.
| Compound Name | 2-(11,13,13-trimethyl-7,15-dioxo-1,3,5,8-tetraza-13-azoniatricyclo[6.6.1.02,6]pentadec-3-en-5-yl)acetic acid |
|---|---|
| PubChem CID | 123463439 |
| Molecular Formula | C15H24N5O4+ |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 2-(11,13,13-trimethyl-7,15-dioxo-1,3,5,8-tetraza-13-azoniatricyclo[6.6.1.02,6]pentadec-3-en-5-yl)acetic acid |
| SMILES | CC1CCN2C(=O)C3C(N=CN3CC(=O)O)N(C[N+](C)(C)C1)C2=O |
| InChI | InChI=1S/C15H23N5O4/c1-10-4-5-18-14(23)12-13(16-8-17(12)6-11(21)22)19(15(18)24)9-20(2,3)7-10/h8,10,12-13H,4-7,9H2,1-3H3/p+1 |
| InChIKey | HCIKVHYTSONOFJ-UHFFFAOYSA-O |
| XLogP | -0.55 |
| TPSA | 93.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|