C8H10N4O4 — CID 73257363
2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetic acid (PubChem CID 73257363) has the molecular formula C8H10N4O4 and a molecular weight of 226.19 g/mol. Its IUPAC name is 2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetic acid.
| Compound Name | 2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetic acid |
|---|---|
| PubChem CID | 73257363 |
| Molecular Formula | C8H10N4O4 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetic acid |
| SMILES | CN1C(=O)NC(=O)C2C1N=CN2CC(=O)O |
| InChI | InChI=1S/C8H10N4O4/c1-11-6-5(7(15)10-8(11)16)12(3-9-6)2-4(13)14/h3,5-6H,2H2,1H3,(H,13,14)(H,10,15,16) |
| InChIKey | YILQAHWQOJVSTL-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |