2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetic acid

C8H10N4O4 — CID 73257363

IUPAC2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetic acid
SMILESCN1C(=O)NC(=O)C2C1N=CN2CC(=O)O
InChIInChI=1S/C8H10N4O4/c1-11-6-5(7(15)10-8(11)16)12(3-9-6)2-4(13)14/h3,5-6H,2H2,1H3,(H,13,14)(H,10,15,16)
InChIKeyYILQAHWQOJVSTL-UHFFFAOYSA-N
MW226.19 g/mol
LogP-1.71
Rot. Bonds2

About 2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetic acid

2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetic acid (PubChem CID 73257363) has the molecular formula C8H10N4O4 and a molecular weight of 226.19 g/mol. Its IUPAC name is 2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetic acid.

Molecular Properties

Compound Name2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetic acid
PubChem CID73257363
Molecular FormulaC8H10N4O4
Molecular Weight226.19 g/mol
Exact Mass226.07
IUPAC Name2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetic acid
SMILESCN1C(=O)NC(=O)C2C1N=CN2CC(=O)O
InChIInChI=1S/C8H10N4O4/c1-11-6-5(7(15)10-8(11)16)12(3-9-6)2-4(13)14/h3,5-6H,2H2,1H3,(H,13,14)(H,10,15,16)
InChIKeyYILQAHWQOJVSTL-UHFFFAOYSA-N
XLogP-1.71
TPSA102.31 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.19
LogP ≤ 5-1.71
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetic acid?
The IUPAC name of 2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetic acid (CID 73257363) is 2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetic acid.
What is the SMILES notation for 2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetic acid?
The canonical SMILES for 2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetic acid is CN1C(=O)NC(=O)C2C1N=CN2CC(=O)O.
What is the InChIKey of 2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetic acid?
The InChIKey is YILQAHWQOJVSTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O4/c1-11-6-5(7(15)10-8(11)16)12(3-9-6)2-4(13)14/h3,5-6H,2H2,1H3,(H,13,14)(H,10,15,16).
What are the key properties of 2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetic acid?
2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetic acid has a molecular weight of 226.19 g/mol, XLogP of -1.71, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-2,6-dioxo-4,5-dihydropurin-7-yl)acetic acid is sourced from PubChem (CID 73257363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).