C9H13N4O2+ — CID 71304102
1,3,7,8-tetramethyl-5H-purin-7-ium-2,6-dione (PubChem CID 71304102) has the molecular formula C9H13N4O2+ and a molecular weight of 209.23 g/mol. Its IUPAC name is 1,3,7,8-tetramethyl-5H-purin-7-ium-2,6-dione.
| Compound Name | 1,3,7,8-tetramethyl-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 71304102 |
| Molecular Formula | C9H13N4O2+ |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 1,3,7,8-tetramethyl-5H-purin-7-ium-2,6-dione |
| SMILES | CC1=[N+](C)C2C(=O)N(C)C(=O)N(C)C2=N1 |
| InChI | InChI=1S/C9H13N4O2/c1-5-10-7-6(11(5)2)8(14)13(4)9(15)12(7)3/h6H,1-4H3/q+1 |
| InChIKey | ZKINMOLAUXLIEN-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|