C7H8N4O2 — CID 24870807
1,7-dimethyl-5H-purine-2,6-dione (PubChem CID 24870807) has the molecular formula C7H8N4O2 and a molecular weight of 180.17 g/mol. Its IUPAC name is 1,7-dimethyl-5H-purine-2,6-dione.
| Compound Name | 1,7-dimethyl-5H-purine-2,6-dione |
|---|---|
| PubChem CID | 24870807 |
| Molecular Formula | C7H8N4O2 |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 1,7-dimethyl-5H-purine-2,6-dione |
| SMILES | CN1C(=O)N=C2N=CN(C)C2C1=O |
| InChI | InChI=1S/C7H8N4O2/c1-10-3-8-5-4(10)6(12)11(2)7(13)9-5/h3-4H,1-2H3 |
| InChIKey | ITLUHQDTLNZFHB-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 65.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |