C11H14N5O4+ — CID 139269499
2-[3-methyl-2,6-dioxo-1-(2-oxopropyl)-5H-purin-7-ium-7-yl]acetamide (PubChem CID 139269499) has the molecular formula C11H14N5O4+ and a molecular weight of 280.26 g/mol. Its IUPAC name is 2-[3-methyl-2,6-dioxo-1-(2-oxopropyl)-5H-purin-7-ium-7-yl]acetamide.
| Compound Name | 2-[3-methyl-2,6-dioxo-1-(2-oxopropyl)-5H-purin-7-ium-7-yl]acetamide |
|---|---|
| PubChem CID | 139269499 |
| Molecular Formula | C11H14N5O4+ |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-[3-methyl-2,6-dioxo-1-(2-oxopropyl)-5H-purin-7-ium-7-yl]acetamide |
| SMILES | CC(=O)CN1C(=O)C2C(=NC=[N+]2CC(N)=O)N(C)C1=O |
| InChI | InChI=1S/C11H13N5O4/c1-6(17)3-16-10(19)8-9(14(2)11(16)20)13-5-15(8)4-7(12)18/h5,8H,3-4H2,1-2H3,(H-,12,18)/p+1 |
| InChIKey | HEPHIMMBHVWMQC-UHFFFAOYSA-O |
| XLogP | -2.22 |
| TPSA | 116.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|