C9H12N5O2+ — CID 78170074
(1,3-dimethyl-2,6-dioxopurin-8-ylidene)-dimethylazanium (PubChem CID 78170074) has the molecular formula C9H12N5O2+ and a molecular weight of 222.23 g/mol. Its IUPAC name is (1,3-dimethyl-2,6-dioxopurin-8-ylidene)-dimethylazanium.
| Compound Name | (1,3-dimethyl-2,6-dioxopurin-8-ylidene)-dimethylazanium |
|---|---|
| PubChem CID | 78170074 |
| Molecular Formula | C9H12N5O2+ |
| Molecular Weight | 222.23 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | (1,3-dimethyl-2,6-dioxopurin-8-ylidene)-dimethylazanium |
| SMILES | Cn1c(=O)c2c(n(C)c1=O)=NC(=[N+](C)C)N=2 |
| InChI | InChI=1S/C9H12N5O2/c1-12(2)8-10-5-6(11-8)13(3)9(16)14(4)7(5)15/h1-4H3/q+1 |
| InChIKey | RISDAHHBELTXEC-UHFFFAOYSA-N |
| XLogP | -3.04 |
| TPSA | 71.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.23 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|