C11H18N5O3+ — CID 73414693
2-hydroxyethyl-methyl-(1,3,7-trimethyl-2,6-dioxo-5H-purin-8-ylidene)azanium (PubChem CID 73414693) has the molecular formula C11H18N5O3+ and a molecular weight of 268.30 g/mol. Its IUPAC name is 2-hydroxyethyl-methyl-(1,3,7-trimethyl-2,6-dioxo-5H-purin-8-ylidene)azanium.
| Compound Name | 2-hydroxyethyl-methyl-(1,3,7-trimethyl-2,6-dioxo-5H-purin-8-ylidene)azanium |
|---|---|
| PubChem CID | 73414693 |
| Molecular Formula | C11H18N5O3+ |
| Molecular Weight | 268.30 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-hydroxyethyl-methyl-(1,3,7-trimethyl-2,6-dioxo-5H-purin-8-ylidene)azanium |
| SMILES | CN1C(=O)C2C(=N/C(=[N+](\C)CCO)N2C)N(C)C1=O |
| InChI | InChI=1S/C11H18N5O3/c1-13(5-6-17)10-12-8-7(14(10)2)9(18)16(4)11(19)15(8)3/h7,17H,5-6H2,1-4H3/q+1 |
| InChIKey | QYJKJBVMEPLHBT-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.30 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|