C9H10N4O3 — CID 75611369
1,3-diethylpurine-2,6,8-trione (PubChem CID 75611369) has the molecular formula C9H10N4O3 and a molecular weight of 222.20 g/mol. Its IUPAC name is 1,3-diethylpurine-2,6,8-trione.
| Compound Name | 1,3-diethylpurine-2,6,8-trione |
|---|---|
| PubChem CID | 75611369 |
| Molecular Formula | C9H10N4O3 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 1,3-diethylpurine-2,6,8-trione |
| SMILES | CCn1c(=O)c2c(n(CC)c1=O)=NC(=O)N=2 |
| InChI | InChI=1S/C9H10N4O3/c1-3-12-6-5(10-8(15)11-6)7(14)13(4-2)9(12)16/h3-4H2,1-2H3 |
| InChIKey | GBYSJRWXSIKLFT-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 85.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |