C7H5F2IN2O2 — CID 118801169
4-(difluoromethyl)-5-iodo-6-oxo-1H-pyridine-2-carboxamide (PubChem CID 118801169) has the molecular formula C7H5F2IN2O2 and a molecular weight of 314.03 g/mol. Its IUPAC name is 4-(difluoromethyl)-5-iodo-6-oxo-1H-pyridine-2-carboxamide.
| Compound Name | 4-(difluoromethyl)-5-iodo-6-oxo-1H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 118801169 |
| Molecular Formula | C7H5F2IN2O2 |
| Molecular Weight | 314.03 g/mol |
| Exact Mass | 313.94 |
| IUPAC Name | 4-(difluoromethyl)-5-iodo-6-oxo-1H-pyridine-2-carboxamide |
| SMILES | NC(=O)c1cc(C(F)F)c(I)c(=O)[nH]1 |
| InChI | InChI=1S/C7H5F2IN2O2/c8-5(9)2-1-3(6(11)13)12-7(14)4(2)10/h1,5H,(H2,11,13)(H,12,14) |
| InChIKey | BVHMUYWXVQPVTR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.03 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|