C8H8F2N2O3 — CID 133102509
5-(aminomethyl)-4-(difluoromethyl)-6-oxo-1H-pyridine-2-carboxylic acid (PubChem CID 133102509) has the molecular formula C8H8F2N2O3 and a molecular weight of 218.16 g/mol. Its IUPAC name is 5-(aminomethyl)-4-(difluoromethyl)-6-oxo-1H-pyridine-2-carboxylic acid.
| Compound Name | 5-(aminomethyl)-4-(difluoromethyl)-6-oxo-1H-pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 133102509 |
| Molecular Formula | C8H8F2N2O3 |
| Molecular Weight | 218.16 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 5-(aminomethyl)-4-(difluoromethyl)-6-oxo-1H-pyridine-2-carboxylic acid |
| SMILES | NCc1c(C(F)F)cc(C(=O)O)[nH]c1=O |
| InChI | InChI=1S/C8H8F2N2O3/c9-6(10)3-1-5(8(14)15)12-7(13)4(3)2-11/h1,6H,2,11H2,(H,12,13)(H,14,15) |
| InChIKey | YZXMBDOJNLLMSS-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.16 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |