C9H5BrF5NO — CID 118801665
4-(bromomethyl)-5-(difluoromethyl)-6-(trifluoromethyl)pyridine-2-carbaldehyde (PubChem CID 118801665) has the molecular formula C9H5BrF5NO and a molecular weight of 318.04 g/mol. Its IUPAC name is 4-(bromomethyl)-5-(difluoromethyl)-6-(trifluoromethyl)pyridine-2-carbaldehyde.
| Compound Name | 4-(bromomethyl)-5-(difluoromethyl)-6-(trifluoromethyl)pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 118801665 |
| Molecular Formula | C9H5BrF5NO |
| Molecular Weight | 318.04 g/mol |
| Exact Mass | 316.95 |
| IUPAC Name | 4-(bromomethyl)-5-(difluoromethyl)-6-(trifluoromethyl)pyridine-2-carbaldehyde |
| SMILES | O=Cc1cc(CBr)c(C(F)F)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H5BrF5NO/c10-2-4-1-5(3-17)16-7(9(13,14)15)6(4)8(11)12/h1,3,8H,2H2 |
| InChIKey | YUDNMJQOBAXHOQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.04 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|