C8H7F3N2O — CID 118812841
4-(aminomethyl)-5-(difluoromethyl)-6-fluoropyridine-2-carbaldehyde (PubChem CID 118812841) has the molecular formula C8H7F3N2O and a molecular weight of 204.15 g/mol. Its IUPAC name is 4-(aminomethyl)-5-(difluoromethyl)-6-fluoropyridine-2-carbaldehyde.
| Compound Name | 4-(aminomethyl)-5-(difluoromethyl)-6-fluoropyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 118812841 |
| Molecular Formula | C8H7F3N2O |
| Molecular Weight | 204.15 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 4-(aminomethyl)-5-(difluoromethyl)-6-fluoropyridine-2-carbaldehyde |
| SMILES | NCc1cc(C=O)nc(F)c1C(F)F |
| InChI | InChI=1S/C8H7F3N2O/c9-7(10)6-4(2-12)1-5(3-14)13-8(6)11/h1,3,7H,2,12H2 |
| InChIKey | WVCGJRMRENBJCW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.15 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|