C8H8F5N3O2S — CID 118808682
6-(aminomethyl)-5-(difluoromethyl)-3-(trifluoromethyl)pyridine-2-sulfonamide (PubChem CID 118808682) has the molecular formula C8H8F5N3O2S and a molecular weight of 305.23 g/mol. Its IUPAC name is 6-(aminomethyl)-5-(difluoromethyl)-3-(trifluoromethyl)pyridine-2-sulfonamide.
| Compound Name | 6-(aminomethyl)-5-(difluoromethyl)-3-(trifluoromethyl)pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 118808682 |
| Molecular Formula | C8H8F5N3O2S |
| Molecular Weight | 305.23 g/mol |
| Exact Mass | 305.03 |
| IUPAC Name | 6-(aminomethyl)-5-(difluoromethyl)-3-(trifluoromethyl)pyridine-2-sulfonamide |
| SMILES | NCc1nc(S(N)(=O)=O)c(C(F)(F)F)cc1C(F)F |
| InChI | InChI=1S/C8H8F5N3O2S/c9-6(10)3-1-4(8(11,12)13)7(19(15,17)18)16-5(3)2-14/h1,6H,2,14H2,(H2,15,17,18) |
| InChIKey | RZMMMYMWYKCHGP-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.23 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |