C8H6ClF5N2O2S — CID 133084830
3-(aminomethyl)-5-(difluoromethyl)-6-(trifluoromethyl)pyridine-2-sulfonyl chloride (PubChem CID 133084830) has the molecular formula C8H6ClF5N2O2S and a molecular weight of 324.66 g/mol. Its IUPAC name is 3-(aminomethyl)-5-(difluoromethyl)-6-(trifluoromethyl)pyridine-2-sulfonyl chloride.
| Compound Name | 3-(aminomethyl)-5-(difluoromethyl)-6-(trifluoromethyl)pyridine-2-sulfonyl chloride |
|---|---|
| PubChem CID | 133084830 |
| Molecular Formula | C8H6ClF5N2O2S |
| Molecular Weight | 324.66 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | 3-(aminomethyl)-5-(difluoromethyl)-6-(trifluoromethyl)pyridine-2-sulfonyl chloride |
| SMILES | NCc1cc(C(F)F)c(C(F)(F)F)nc1S(=O)(=O)Cl |
| InChI | InChI=1S/C8H6ClF5N2O2S/c9-19(17,18)7-3(2-15)1-4(6(10)11)5(16-7)8(12,13)14/h1,6H,2,15H2 |
| InChIKey | SAQYRDPRELOEFG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.66 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |