C8H4BrClF5NO2S — CID 118837901
6-(bromomethyl)-5-(difluoromethyl)-2-(trifluoromethyl)pyridine-3-sulfonyl chloride (PubChem CID 118837901) has the molecular formula C8H4BrClF5NO2S and a molecular weight of 388.54 g/mol. Its IUPAC name is 6-(bromomethyl)-5-(difluoromethyl)-2-(trifluoromethyl)pyridine-3-sulfonyl chloride.
| Compound Name | 6-(bromomethyl)-5-(difluoromethyl)-2-(trifluoromethyl)pyridine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 118837901 |
| Molecular Formula | C8H4BrClF5NO2S |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 386.88 |
| IUPAC Name | 6-(bromomethyl)-5-(difluoromethyl)-2-(trifluoromethyl)pyridine-3-sulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1cc(C(F)F)c(CBr)nc1C(F)(F)F |
| InChI | InChI=1S/C8H4BrClF5NO2S/c9-2-4-3(7(11)12)1-5(19(10,17)18)6(16-4)8(13,14)15/h1,7H,2H2 |
| InChIKey | SRVKIWDTCCOZTI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|