C8H8ClF2NO2 — CID 118811368
4-chloro-2-(difluoromethyl)-3,6-dimethoxypyridine (PubChem CID 118811368) has the molecular formula C8H8ClF2NO2 and a molecular weight of 223.61 g/mol. Its IUPAC name is 4-chloro-2-(difluoromethyl)-3,6-dimethoxypyridine.
| Compound Name | 4-chloro-2-(difluoromethyl)-3,6-dimethoxypyridine |
|---|---|
| PubChem CID | 118811368 |
| Molecular Formula | C8H8ClF2NO2 |
| Molecular Weight | 223.61 g/mol |
| Exact Mass | 223.02 |
| IUPAC Name | 4-chloro-2-(difluoromethyl)-3,6-dimethoxypyridine |
| SMILES | COc1cc(Cl)c(OC)c(C(F)F)n1 |
| InChI | InChI=1S/C8H8ClF2NO2/c1-13-5-3-4(9)7(14-2)6(12-5)8(10)11/h3,8H,1-2H3 |
| InChIKey | HEPNGIMLPYQYKU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.61 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |