About 2-(difluoromethyl)-3,6-dimethoxypyridine-4-sulfonyl chloride
2-(difluoromethyl)-3,6-dimethoxypyridine-4-sulfonyl chloride (PubChem CID 118837893) has the molecular formula C8H8ClF2NO4S
and a molecular weight of 287.67 g/mol. Its IUPAC name is 2-(difluoromethyl)-3,6-dimethoxypyridine-4-sulfonyl chloride.
Analyze 2-(difluoromethyl)-3,6-dimethoxypyridine-4-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-3,6-dimethoxypyridine-4-sulfonyl chloride?
The IUPAC name of 2-(difluoromethyl)-3,6-dimethoxypyridine-4-sulfonyl chloride (CID 118837893) is 2-(difluoromethyl)-3,6-dimethoxypyridine-4-sulfonyl chloride.
What is the SMILES notation for 2-(difluoromethyl)-3,6-dimethoxypyridine-4-sulfonyl chloride?
The canonical SMILES for 2-(difluoromethyl)-3,6-dimethoxypyridine-4-sulfonyl chloride is COc1cc(S(=O)(=O)Cl)c(OC)c(C(F)F)n1.
What is the InChIKey of 2-(difluoromethyl)-3,6-dimethoxypyridine-4-sulfonyl chloride?
The InChIKey is HQBPQUXURCBQDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8ClF2NO4S/c1-15-5-3-4(17(9,13)14)7(16-2)6(12-5)8(10)11/h3,8H,1-2H3.
What are the key properties of 2-(difluoromethyl)-3,6-dimethoxypyridine-4-sulfonyl chloride?
2-(difluoromethyl)-3,6-dimethoxypyridine-4-sulfonyl chloride has a molecular weight of 287.67 g/mol, XLogP of 1.96, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-3,6-dimethoxypyridine-4-sulfonyl chloride is sourced from PubChem (CID 118837893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).