C7H6F4N2O2 — CID 118811668
4-amino-5-(fluoromethyl)-2-(trifluoromethoxy)pyridin-3-ol (PubChem CID 118811668) has the molecular formula C7H6F4N2O2 and a molecular weight of 226.13 g/mol. Its IUPAC name is 4-amino-5-(fluoromethyl)-2-(trifluoromethoxy)pyridin-3-ol.
| Compound Name | 4-amino-5-(fluoromethyl)-2-(trifluoromethoxy)pyridin-3-ol |
|---|---|
| PubChem CID | 118811668 |
| Molecular Formula | C7H6F4N2O2 |
| Molecular Weight | 226.13 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 4-amino-5-(fluoromethyl)-2-(trifluoromethoxy)pyridin-3-ol |
| SMILES | Nc1c(CF)cnc(OC(F)(F)F)c1O |
| InChI | InChI=1S/C7H6F4N2O2/c8-1-3-2-13-6(5(14)4(3)12)15-7(9,10)11/h2,14H,1H2,(H2,12,13) |
| InChIKey | TYWUNWQYZLDWCF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.13 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |