C7H6F2INO2 — CID 118812764
4-(difluoromethyl)-6-iodo-5-methoxy-1H-pyridin-2-one (PubChem CID 118812764) has the molecular formula C7H6F2INO2 and a molecular weight of 301.03 g/mol. Its IUPAC name is 4-(difluoromethyl)-6-iodo-5-methoxy-1H-pyridin-2-one.
| Compound Name | 4-(difluoromethyl)-6-iodo-5-methoxy-1H-pyridin-2-one |
|---|---|
| PubChem CID | 118812764 |
| Molecular Formula | C7H6F2INO2 |
| Molecular Weight | 301.03 g/mol |
| Exact Mass | 300.94 |
| IUPAC Name | 4-(difluoromethyl)-6-iodo-5-methoxy-1H-pyridin-2-one |
| SMILES | COc1c(C(F)F)cc(=O)[nH]c1I |
| InChI | InChI=1S/C7H6F2INO2/c1-13-5-3(6(8)9)2-4(12)11-7(5)10/h2,6H,1H3,(H,11,12) |
| InChIKey | JNPFCYUQRLCWTJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.03 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|