C21H23N3O6S2 — CID 1188153
(E)-N-[6-(dimethylsulfamoyl)-1,3-benzothiazol-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 1188153) has the molecular formula C21H23N3O6S2 and a molecular weight of 477.56 g/mol. Its IUPAC name is (E)-N-[6-(dimethylsulfamoyl)-1,3-benzothiazol-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[6-(dimethylsulfamoyl)-1,3-benzothiazol-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 1188153 |
| Molecular Formula | C21H23N3O6S2 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | (E)-N-[6-(dimethylsulfamoyl)-1,3-benzothiazol-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2nc3ccc(S(=O)(=O)N(C)C)cc3s2)cc(OC)c1OC |
| InChI | InChI=1S/C21H23N3O6S2/c1-24(2)32(26,27)14-7-8-15-18(12-14)31-21(22-15)23-19(25)9-6-13-10-16(28-3)20(30-5)17(11-13)29-4/h6-12H,1-5H3,(H,22,23,25)/b9-6+ |
| InChIKey | HKEZTFCKZOQEKN-RMKNXTFCSA-N |
| XLogP | 3.22 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|