C18H17NO6 — CID 11881705
(3aR,4R,7S,7aR)-2-(5-acetyl-2-methoxyphenyl)-7-(hydroxymethyl)-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione (PubChem CID 11881705) has the molecular formula C18H17NO6 and a molecular weight of 343.34 g/mol. Its IUPAC name is (3aR,4R,7S,7aR)-2-(5-acetyl-2-methoxyphenyl)-7-(hydroxymethyl)-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione.
| Compound Name | (3aR,4R,7S,7aR)-2-(5-acetyl-2-methoxyphenyl)-7-(hydroxymethyl)-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione |
|---|---|
| PubChem CID | 11881705 |
| Molecular Formula | C18H17NO6 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | (3aR,4R,7S,7aR)-2-(5-acetyl-2-methoxyphenyl)-7-(hydroxymethyl)-4,7a-dihydro-3aH-4,7-epoxyisoindole-1,3-dione |
| SMILES | COc1ccc(C(C)=O)cc1N1C(=O)[C@@H]2[C@@H](C1=O)[C@]1(CO)C=C[C@H]2O1 |
| InChI | InChI=1S/C18H17NO6/c1-9(21)10-3-4-12(24-2)11(7-10)19-16(22)14-13-5-6-18(8-20,25-13)15(14)17(19)23/h3-7,13-15,20H,8H2,1-2H3/t13-,14+,15+,18-/m1/s1 |
| InChIKey | BPDYHHRWWLUABH-LDDOYCOJSA-N |
| XLogP | 0.70 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|