C19H19NO7 — CID 126295405
[(3aS,4R,7R,7aR)-2-(2,5-dimethoxyphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl acetate (PubChem CID 126295405) has the molecular formula C19H19NO7 and a molecular weight of 373.36 g/mol. Its IUPAC name is [(3aS,4R,7R,7aR)-2-(2,5-dimethoxyphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl acetate.
| Compound Name | [(3aS,4R,7R,7aR)-2-(2,5-dimethoxyphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl acetate |
|---|---|
| PubChem CID | 126295405 |
| Molecular Formula | C19H19NO7 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | [(3aS,4R,7R,7aR)-2-(2,5-dimethoxyphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl acetate |
| SMILES | COc1ccc(OC)c(N2C(=O)[C@H]3[C@H]4C=C[C@@](COC(C)=O)(O4)[C@H]3C2=O)c1 |
| InChI | InChI=1S/C19H19NO7/c1-10(21)26-9-19-7-6-14(27-19)15-16(19)18(23)20(17(15)22)12-8-11(24-2)4-5-13(12)25-3/h4-8,14-16H,9H2,1-3H3/t14-,15+,16-,19+/m1/s1 |
| InChIKey | LTACZUYLQZYWHP-OLMMMNRUSA-N |
| XLogP | 1.08 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|