C21H21NO9 — CID 126298166
[[(3aR,4R,7R,7aR)-2-(2,5-dimethoxyphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]-acetyloxymethyl] acetate (PubChem CID 126298166) has the molecular formula C21H21NO9 and a molecular weight of 431.40 g/mol. Its IUPAC name is [[(3aR,4R,7R,7aR)-2-(2,5-dimethoxyphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]-acetyloxymethyl] acetate.
| Compound Name | [[(3aR,4R,7R,7aR)-2-(2,5-dimethoxyphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]-acetyloxymethyl] acetate |
|---|---|
| PubChem CID | 126298166 |
| Molecular Formula | C21H21NO9 |
| Molecular Weight | 431.40 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | [[(3aR,4R,7R,7aR)-2-(2,5-dimethoxyphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]-acetyloxymethyl] acetate |
| SMILES | COc1ccc(OC)c(N2C(=O)[C@@H]3[C@@H](C2=O)[C@@]2(C(OC(C)=O)OC(C)=O)C=C[C@H]3O2)c1 |
| InChI | InChI=1S/C21H21NO9/c1-10(23)29-20(30-11(2)24)21-8-7-15(31-21)16-17(21)19(26)22(18(16)25)13-9-12(27-3)5-6-14(13)28-4/h5-9,15-17,20H,1-4H3/t15-,16+,17+,21-/m1/s1 |
| InChIKey | RSYLUHCCJVPJTB-MXTNKPTQSA-N |
| XLogP | 0.97 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.40 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|