C20H18ClNO7 — CID 2911452
[acetyloxy-[2-(5-chloro-2-methylphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl] acetate (PubChem CID 2911452) has the molecular formula C20H18ClNO7 and a molecular weight of 419.82 g/mol. Its IUPAC name is [acetyloxy-[2-(5-chloro-2-methylphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl] acetate.
| Compound Name | [acetyloxy-[2-(5-chloro-2-methylphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl] acetate |
|---|---|
| PubChem CID | 2911452 |
| Molecular Formula | C20H18ClNO7 |
| Molecular Weight | 419.82 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | [acetyloxy-[2-(5-chloro-2-methylphenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl] acetate |
| SMILES | CC(=O)OC(OC(C)=O)C12C=CC(O1)C1C(=O)N(c3cc(Cl)ccc3C)C(=O)C12 |
| InChI | InChI=1S/C20H18ClNO7/c1-9-4-5-12(21)8-13(9)22-17(25)15-14-6-7-20(29-14,16(15)18(22)26)19(27-10(2)23)28-11(3)24/h4-8,14-16,19H,1-3H3 |
| InChIKey | CKCPYUOCXXQMIH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.82 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|