C18H17N3O8 — CID 126301405
[[(3aR,4R,7R,7aS)-2-(6-methoxypyridazin-3-yl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]-acetyloxymethyl] acetate (PubChem CID 126301405) has the molecular formula C18H17N3O8 and a molecular weight of 403.35 g/mol. Its IUPAC name is [[(3aR,4R,7R,7aS)-2-(6-methoxypyridazin-3-yl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]-acetyloxymethyl] acetate.
| Compound Name | [[(3aR,4R,7R,7aS)-2-(6-methoxypyridazin-3-yl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]-acetyloxymethyl] acetate |
|---|---|
| PubChem CID | 126301405 |
| Molecular Formula | C18H17N3O8 |
| Molecular Weight | 403.35 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | [[(3aR,4R,7R,7aS)-2-(6-methoxypyridazin-3-yl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]-acetyloxymethyl] acetate |
| SMILES | COc1ccc(N2C(=O)[C@H]3[C@@H](C2=O)[C@@]2(C(OC(C)=O)OC(C)=O)C=C[C@H]3O2)nn1 |
| InChI | InChI=1S/C18H17N3O8/c1-8(22)27-17(28-9(2)23)18-7-6-10(29-18)13-14(18)16(25)21(15(13)24)11-4-5-12(26-3)20-19-11/h4-7,10,13-14,17H,1-3H3/t10-,13-,14+,18-/m1/s1 |
| InChIKey | DLGNAAJTKCRCTL-GAMKEXDWSA-N |
| XLogP | -0.25 |
| TPSA | 134.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.35 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|