C17H14INO5 — CID 126283668
[(3aR,4S,7R,7aR)-2-(3-iodophenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl acetate (PubChem CID 126283668) has the molecular formula C17H14INO5 and a molecular weight of 439.21 g/mol. Its IUPAC name is [(3aR,4S,7R,7aR)-2-(3-iodophenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl acetate.
| Compound Name | [(3aR,4S,7R,7aR)-2-(3-iodophenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl acetate |
|---|---|
| PubChem CID | 126283668 |
| Molecular Formula | C17H14INO5 |
| Molecular Weight | 439.21 g/mol |
| Exact Mass | 438.99 |
| IUPAC Name | [(3aR,4S,7R,7aR)-2-(3-iodophenyl)-1,3-dioxo-7,7a-dihydro-3aH-4,7-epoxyisoindol-4-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@]12C=C[C@@H](O1)[C@@H]1C(=O)N(c3cccc(I)c3)C(=O)[C@H]12 |
| InChI | InChI=1S/C17H14INO5/c1-9(20)23-8-17-6-5-12(24-17)13-14(17)16(22)19(15(13)21)11-4-2-3-10(18)7-11/h2-7,12-14H,8H2,1H3/t12-,13+,14+,17-/m1/s1 |
| InChIKey | AQRCUTRPJFKMNR-XJIUQZFPSA-N |
| XLogP | 1.67 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.21 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|