C13H5Cl4F3 — CID 118818698
1,2,5-trichloro-3-[5-chloro-4-(difluoromethyl)-2-fluorophenyl]benzene (PubChem CID 118818698) has the molecular formula C13H5Cl4F3 and a molecular weight of 359.99 g/mol. Its IUPAC name is 1,2,5-trichloro-3-[5-chloro-4-(difluoromethyl)-2-fluorophenyl]benzene.
| Compound Name | 1,2,5-trichloro-3-[5-chloro-4-(difluoromethyl)-2-fluorophenyl]benzene |
|---|---|
| PubChem CID | 118818698 |
| Molecular Formula | C13H5Cl4F3 |
| Molecular Weight | 359.99 g/mol |
| Exact Mass | 357.91 |
| IUPAC Name | 1,2,5-trichloro-3-[5-chloro-4-(difluoromethyl)-2-fluorophenyl]benzene |
| SMILES | Fc1cc(C(F)F)c(Cl)cc1-c1cc(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C13H5Cl4F3/c14-5-1-7(12(17)10(16)2-5)6-3-9(15)8(13(19)20)4-11(6)18/h1-4,13H |
| InChIKey | PEZIGXJFOXRLBR-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.99 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|