C9H8F5N3O — CID 118824321
4-(aminomethyl)-6-(difluoromethyl)-2-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 118824321) has the molecular formula C9H8F5N3O and a molecular weight of 269.17 g/mol. Its IUPAC name is 4-(aminomethyl)-6-(difluoromethyl)-2-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 4-(aminomethyl)-6-(difluoromethyl)-2-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118824321 |
| Molecular Formula | C9H8F5N3O |
| Molecular Weight | 269.17 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 4-(aminomethyl)-6-(difluoromethyl)-2-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | NCc1cc(C(F)F)nc(C(F)(F)F)c1C(N)=O |
| InChI | InChI=1S/C9H8F5N3O/c10-7(11)4-1-3(2-15)5(8(16)18)6(17-4)9(12,13)14/h1,7H,2,15H2,(H2,16,18) |
| InChIKey | DMHZOVKEVQZCEP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.17 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |