C12H13F5N2O2 — CID 133084760
ethyl 2-[4-(aminomethyl)-6-(difluoromethyl)-2-(trifluoromethyl)-3-pyridinyl]acetate (PubChem CID 133084760) has the molecular formula C12H13F5N2O2 and a molecular weight of 312.24 g/mol. Its IUPAC name is ethyl 2-[4-(aminomethyl)-6-(difluoromethyl)-2-(trifluoromethyl)-3-pyridinyl]acetate.
| Compound Name | ethyl 2-[4-(aminomethyl)-6-(difluoromethyl)-2-(trifluoromethyl)-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 133084760 |
| Molecular Formula | C12H13F5N2O2 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | ethyl 2-[4-(aminomethyl)-6-(difluoromethyl)-2-(trifluoromethyl)-3-pyridinyl]acetate |
| SMILES | CCOC(=O)Cc1c(CN)cc(C(F)F)nc1C(F)(F)F |
| InChI | InChI=1S/C12H13F5N2O2/c1-2-21-9(20)4-7-6(5-18)3-8(11(13)14)19-10(7)12(15,16)17/h3,11H,2,4-5,18H2,1H3 |
| InChIKey | PLRABUGJQUEMDN-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |