C12H7Cl2F2NO — CID 118825016
2-(2,6-dichlorophenyl)-5-(difluoromethoxy)pyridine (PubChem CID 118825016) has the molecular formula C12H7Cl2F2NO and a molecular weight of 290.10 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-5-(difluoromethoxy)pyridine.
| Compound Name | 2-(2,6-dichlorophenyl)-5-(difluoromethoxy)pyridine |
|---|---|
| PubChem CID | 118825016 |
| Molecular Formula | C12H7Cl2F2NO |
| Molecular Weight | 290.10 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-5-(difluoromethoxy)pyridine |
| SMILES | FC(F)Oc1ccc(-c2c(Cl)cccc2Cl)nc1 |
| InChI | InChI=1S/C12H7Cl2F2NO/c13-8-2-1-3-9(14)11(8)10-5-4-7(6-17-10)18-12(15)16/h1-6,12H |
| InChIKey | GIYBUTILGOUNHV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.10 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |