C8H3F5INO3 — CID 118828504
4-(difluoromethyl)-3-iodo-5-(trifluoromethoxy)pyridine-2-carboxylic acid (PubChem CID 118828504) has the molecular formula C8H3F5INO3 and a molecular weight of 383.01 g/mol. Its IUPAC name is 4-(difluoromethyl)-3-iodo-5-(trifluoromethoxy)pyridine-2-carboxylic acid.
| Compound Name | 4-(difluoromethyl)-3-iodo-5-(trifluoromethoxy)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 118828504 |
| Molecular Formula | C8H3F5INO3 |
| Molecular Weight | 383.01 g/mol |
| Exact Mass | 382.91 |
| IUPAC Name | 4-(difluoromethyl)-3-iodo-5-(trifluoromethoxy)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ncc(OC(F)(F)F)c(C(F)F)c1I |
| InChI | InChI=1S/C8H3F5INO3/c9-6(10)3-2(18-8(11,12)13)1-15-5(4(3)14)7(16)17/h1,6H,(H,16,17) |
| InChIKey | PIMQMIPWBNCFOD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.01 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|