C8H3ClF5NO3 — CID 118805459
4-chloro-3-(difluoromethyl)-5-(trifluoromethoxy)pyridine-2-carboxylic acid (PubChem CID 118805459) has the molecular formula C8H3ClF5NO3 and a molecular weight of 291.56 g/mol. Its IUPAC name is 4-chloro-3-(difluoromethyl)-5-(trifluoromethoxy)pyridine-2-carboxylic acid.
| Compound Name | 4-chloro-3-(difluoromethyl)-5-(trifluoromethoxy)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 118805459 |
| Molecular Formula | C8H3ClF5NO3 |
| Molecular Weight | 291.56 g/mol |
| Exact Mass | 290.97 |
| IUPAC Name | 4-chloro-3-(difluoromethyl)-5-(trifluoromethoxy)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ncc(OC(F)(F)F)c(Cl)c1C(F)F |
| InChI | InChI=1S/C8H3ClF5NO3/c9-4-2(18-8(12,13)14)1-15-5(7(16)17)3(4)6(10)11/h1,6H,(H,16,17) |
| InChIKey | NFMULKJKHVFOFC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |