C8H4ClF4NO3 — CID 134658890
3-(chloromethyl)-4-fluoro-5-(trifluoromethoxy)pyridine-2-carboxylic acid (PubChem CID 134658890) has the molecular formula C8H4ClF4NO3 and a molecular weight of 273.57 g/mol. Its IUPAC name is 3-(chloromethyl)-4-fluoro-5-(trifluoromethoxy)pyridine-2-carboxylic acid.
| Compound Name | 3-(chloromethyl)-4-fluoro-5-(trifluoromethoxy)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 134658890 |
| Molecular Formula | C8H4ClF4NO3 |
| Molecular Weight | 273.57 g/mol |
| Exact Mass | 272.98 |
| IUPAC Name | 3-(chloromethyl)-4-fluoro-5-(trifluoromethoxy)pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ncc(OC(F)(F)F)c(F)c1CCl |
| InChI | InChI=1S/C8H4ClF4NO3/c9-1-3-5(10)4(17-8(11,12)13)2-14-6(3)7(15)16/h2H,1H2,(H,15,16) |
| InChIKey | IGEPOKCPUFKZRI-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.57 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|