C7H5ClF2N2O2 — CID 118829139
4-amino-6-(difluoromethyl)-2-oxo-1H-pyridine-3-carbonyl chloride (PubChem CID 118829139) has the molecular formula C7H5ClF2N2O2 and a molecular weight of 222.58 g/mol. Its IUPAC name is 4-amino-6-(difluoromethyl)-2-oxo-1H-pyridine-3-carbonyl chloride.
| Compound Name | 4-amino-6-(difluoromethyl)-2-oxo-1H-pyridine-3-carbonyl chloride |
|---|---|
| PubChem CID | 118829139 |
| Molecular Formula | C7H5ClF2N2O2 |
| Molecular Weight | 222.58 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | 4-amino-6-(difluoromethyl)-2-oxo-1H-pyridine-3-carbonyl chloride |
| SMILES | Nc1cc(C(F)F)[nH]c(=O)c1C(=O)Cl |
| InChI | InChI=1S/C7H5ClF2N2O2/c8-5(13)4-2(11)1-3(6(9)10)12-7(4)14/h1,6H,(H3,11,12,14) |
| InChIKey | VQNVUYCUAQPDJK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.58 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|