C7H5ClF2N2O2 — CID 119005211
2-chloro-6-(difluoromethyl)-4-oxo-1H-pyridine-3-carboxamide (PubChem CID 119005211) has the molecular formula C7H5ClF2N2O2 and a molecular weight of 222.58 g/mol. Its IUPAC name is 2-chloro-6-(difluoromethyl)-4-oxo-1H-pyridine-3-carboxamide.
| Compound Name | 2-chloro-6-(difluoromethyl)-4-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 119005211 |
| Molecular Formula | C7H5ClF2N2O2 |
| Molecular Weight | 222.58 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | 2-chloro-6-(difluoromethyl)-4-oxo-1H-pyridine-3-carboxamide |
| SMILES | NC(=O)c1c(Cl)[nH]c(C(F)F)cc1=O |
| InChI | InChI=1S/C7H5ClF2N2O2/c8-5-4(7(11)14)3(13)1-2(12-5)6(9)10/h1,6H,(H2,11,14)(H,12,13) |
| InChIKey | YMSIJSPUVSCNBY-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 75.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.58 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|