C6H5ClF2N2O3S — CID 130105085
3-amino-6-(difluoromethyl)-4-oxo-1H-pyridine-2-sulfonyl chloride (PubChem CID 130105085) has the molecular formula C6H5ClF2N2O3S and a molecular weight of 258.63 g/mol. Its IUPAC name is 3-amino-6-(difluoromethyl)-4-oxo-1H-pyridine-2-sulfonyl chloride.
| Compound Name | 3-amino-6-(difluoromethyl)-4-oxo-1H-pyridine-2-sulfonyl chloride |
|---|---|
| PubChem CID | 130105085 |
| Molecular Formula | C6H5ClF2N2O3S |
| Molecular Weight | 258.63 g/mol |
| Exact Mass | 257.97 |
| IUPAC Name | 3-amino-6-(difluoromethyl)-4-oxo-1H-pyridine-2-sulfonyl chloride |
| SMILES | Nc1c(S(=O)(=O)Cl)[nH]c(C(F)F)cc1=O |
| InChI | InChI=1S/C6H5ClF2N2O3S/c7-15(13,14)6-4(10)3(12)1-2(11-6)5(8)9/h1,5H,10H2,(H,11,12) |
| InChIKey | CAQPPPFAUUZAAS-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.63 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |