C6H3ClF2INO3S — CID 118811667
4-(difluoromethyl)-3-iodo-6-oxo-1H-pyridine-2-sulfonyl chloride (PubChem CID 118811667) has the molecular formula C6H3ClF2INO3S and a molecular weight of 369.51 g/mol. Its IUPAC name is 4-(difluoromethyl)-3-iodo-6-oxo-1H-pyridine-2-sulfonyl chloride.
| Compound Name | 4-(difluoromethyl)-3-iodo-6-oxo-1H-pyridine-2-sulfonyl chloride |
|---|---|
| PubChem CID | 118811667 |
| Molecular Formula | C6H3ClF2INO3S |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 368.85 |
| IUPAC Name | 4-(difluoromethyl)-3-iodo-6-oxo-1H-pyridine-2-sulfonyl chloride |
| SMILES | O=c1cc(C(F)F)c(I)c(S(=O)(=O)Cl)[nH]1 |
| InChI | InChI=1S/C6H3ClF2INO3S/c7-15(13,14)6-4(10)2(5(8)9)1-3(12)11-6/h1,5H,(H,11,12) |
| InChIKey | ATOIEDBUYUCECB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|