C7H6ClF2NO3S — CID 130084088
6-(difluoromethyl)-2-methyl-4-oxo-1H-pyridine-3-sulfonyl chloride (PubChem CID 130084088) has the molecular formula C7H6ClF2NO3S and a molecular weight of 257.64 g/mol. Its IUPAC name is 6-(difluoromethyl)-2-methyl-4-oxo-1H-pyridine-3-sulfonyl chloride.
| Compound Name | 6-(difluoromethyl)-2-methyl-4-oxo-1H-pyridine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 130084088 |
| Molecular Formula | C7H6ClF2NO3S |
| Molecular Weight | 257.64 g/mol |
| Exact Mass | 256.97 |
| IUPAC Name | 6-(difluoromethyl)-2-methyl-4-oxo-1H-pyridine-3-sulfonyl chloride |
| SMILES | Cc1[nH]c(C(F)F)cc(=O)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C7H6ClF2NO3S/c1-3-6(15(8,13)14)5(12)2-4(11-3)7(9)10/h2,7H,1H3,(H,11,12) |
| InChIKey | CNVPYYYRLDINTI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.64 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |