C8H5F6NO3 — CID 118833449
3-(hydroxymethyl)-2-(trifluoromethoxy)-6-(trifluoromethyl)-1H-pyridin-4-one (PubChem CID 118833449) has the molecular formula C8H5F6NO3 and a molecular weight of 277.12 g/mol. Its IUPAC name is 3-(hydroxymethyl)-2-(trifluoromethoxy)-6-(trifluoromethyl)-1H-pyridin-4-one.
| Compound Name | 3-(hydroxymethyl)-2-(trifluoromethoxy)-6-(trifluoromethyl)-1H-pyridin-4-one |
|---|---|
| PubChem CID | 118833449 |
| Molecular Formula | C8H5F6NO3 |
| Molecular Weight | 277.12 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 3-(hydroxymethyl)-2-(trifluoromethoxy)-6-(trifluoromethyl)-1H-pyridin-4-one |
| SMILES | O=c1cc(C(F)(F)F)[nH]c(OC(F)(F)F)c1CO |
| InChI | InChI=1S/C8H5F6NO3/c9-7(10,11)5-1-4(17)3(2-16)6(15-5)18-8(12,13)14/h1,16H,2H2,(H,15,17) |
| InChIKey | LYRIHKBTPIHQRD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 62.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.12 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |