C8H9ClF2N2O — CID 118836942
[3-chloro-4-(difluoromethyl)-6-methoxy-2-pyridinyl]methanamine (PubChem CID 118836942) has the molecular formula C8H9ClF2N2O and a molecular weight of 222.62 g/mol. Its IUPAC name is [3-chloro-4-(difluoromethyl)-6-methoxy-2-pyridinyl]methanamine.
| Compound Name | [3-chloro-4-(difluoromethyl)-6-methoxy-2-pyridinyl]methanamine |
|---|---|
| PubChem CID | 118836942 |
| Molecular Formula | C8H9ClF2N2O |
| Molecular Weight | 222.62 g/mol |
| Exact Mass | 222.04 |
| IUPAC Name | [3-chloro-4-(difluoromethyl)-6-methoxy-2-pyridinyl]methanamine |
| SMILES | COc1cc(C(F)F)c(Cl)c(CN)n1 |
| InChI | InChI=1S/C8H9ClF2N2O/c1-14-6-2-4(8(10)11)7(9)5(3-12)13-6/h2,8H,3,12H2,1H3 |
| InChIKey | UBIKIFDKSFJFOY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.62 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |