C10H11ClF2N2O2 — CID 134677861
methyl 2-[6-(aminomethyl)-3-chloro-4-(difluoromethyl)-2-pyridinyl]acetate (PubChem CID 134677861) has the molecular formula C10H11ClF2N2O2 and a molecular weight of 264.66 g/mol. Its IUPAC name is methyl 2-[6-(aminomethyl)-3-chloro-4-(difluoromethyl)-2-pyridinyl]acetate.
| Compound Name | methyl 2-[6-(aminomethyl)-3-chloro-4-(difluoromethyl)-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 134677861 |
| Molecular Formula | C10H11ClF2N2O2 |
| Molecular Weight | 264.66 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | methyl 2-[6-(aminomethyl)-3-chloro-4-(difluoromethyl)-2-pyridinyl]acetate |
| SMILES | COC(=O)Cc1nc(CN)cc(C(F)F)c1Cl |
| InChI | InChI=1S/C10H11ClF2N2O2/c1-17-8(16)3-7-9(11)6(10(12)13)2-5(4-14)15-7/h2,10H,3-4,14H2,1H3 |
| InChIKey | LNXDDZKHUDWDSY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.66 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |