C10H13F2N3O2 — CID 134684597
methyl 2-[5-amino-6-(aminomethyl)-4-(difluoromethyl)-2-pyridinyl]acetate (PubChem CID 134684597) has the molecular formula C10H13F2N3O2 and a molecular weight of 245.23 g/mol. Its IUPAC name is methyl 2-[5-amino-6-(aminomethyl)-4-(difluoromethyl)-2-pyridinyl]acetate.
| Compound Name | methyl 2-[5-amino-6-(aminomethyl)-4-(difluoromethyl)-2-pyridinyl]acetate |
|---|---|
| PubChem CID | 134684597 |
| Molecular Formula | C10H13F2N3O2 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | methyl 2-[5-amino-6-(aminomethyl)-4-(difluoromethyl)-2-pyridinyl]acetate |
| SMILES | COC(=O)Cc1cc(C(F)F)c(N)c(CN)n1 |
| InChI | InChI=1S/C10H13F2N3O2/c1-17-8(16)3-5-2-6(10(11)12)9(14)7(4-13)15-5/h2,10H,3-4,13-14H2,1H3 |
| InChIKey | ATVSFIRFFOGUFL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |