methyl 2-[6-bromo-4-(difluoromethyl)-5-iodo-2-pyridinyl]acetate

C9H7BrF2INO2 — CID 134685061

IUPACmethyl 2-[6-bromo-4-(difluoromethyl)-5-iodo-2-pyridinyl]acetate
SMILESCOC(=O)Cc1cc(C(F)F)c(I)c(Br)n1
InChIInChI=1S/C9H7BrF2INO2/c1-16-6(15)3-4-2-5(9(11)12)7(13)8(10)14-4/h2,9H,3H2,1H3
InChIKeyAUPHNSNXHNWVFT-UHFFFAOYSA-N
MW405.96 g/mol
LogP3.10
Rot. Bonds3

About methyl 2-[6-bromo-4-(difluoromethyl)-5-iodo-2-pyridinyl]acetate

methyl 2-[6-bromo-4-(difluoromethyl)-5-iodo-2-pyridinyl]acetate (PubChem CID 134685061) has the molecular formula C9H7BrF2INO2 and a molecular weight of 405.96 g/mol. Its IUPAC name is methyl 2-[6-bromo-4-(difluoromethyl)-5-iodo-2-pyridinyl]acetate.

Molecular Properties

Compound Namemethyl 2-[6-bromo-4-(difluoromethyl)-5-iodo-2-pyridinyl]acetate
PubChem CID134685061
Molecular FormulaC9H7BrF2INO2
Molecular Weight405.96 g/mol
Exact Mass404.87
IUPAC Namemethyl 2-[6-bromo-4-(difluoromethyl)-5-iodo-2-pyridinyl]acetate
SMILESCOC(=O)Cc1cc(C(F)F)c(I)c(Br)n1
InChIInChI=1S/C9H7BrF2INO2/c1-16-6(15)3-4-2-5(9(11)12)7(13)8(10)14-4/h2,9H,3H2,1H3
InChIKeyAUPHNSNXHNWVFT-UHFFFAOYSA-N
XLogP3.10
TPSA39.19 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500405.96
LogP ≤ 53.10
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}

Analyze methyl 2-[6-bromo-4-(difluoromethyl)-5-iodo-2-pyridinyl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[6-bromo-4-(difluoromethyl)-5-iodo-2-pyridinyl]acetate?
The IUPAC name of methyl 2-[6-bromo-4-(difluoromethyl)-5-iodo-2-pyridinyl]acetate (CID 134685061) is methyl 2-[6-bromo-4-(difluoromethyl)-5-iodo-2-pyridinyl]acetate.
What is the SMILES notation for methyl 2-[6-bromo-4-(difluoromethyl)-5-iodo-2-pyridinyl]acetate?
The canonical SMILES for methyl 2-[6-bromo-4-(difluoromethyl)-5-iodo-2-pyridinyl]acetate is COC(=O)Cc1cc(C(F)F)c(I)c(Br)n1.
What is the InChIKey of methyl 2-[6-bromo-4-(difluoromethyl)-5-iodo-2-pyridinyl]acetate?
The InChIKey is AUPHNSNXHNWVFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7BrF2INO2/c1-16-6(15)3-4-2-5(9(11)12)7(13)8(10)14-4/h2,9H,3H2,1H3.
What are the key properties of methyl 2-[6-bromo-4-(difluoromethyl)-5-iodo-2-pyridinyl]acetate?
methyl 2-[6-bromo-4-(difluoromethyl)-5-iodo-2-pyridinyl]acetate has a molecular weight of 405.96 g/mol, XLogP of 3.10, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[6-bromo-4-(difluoromethyl)-5-iodo-2-pyridinyl]acetate is sourced from PubChem (CID 134685061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).