C9H5F5N2O — CID 118839308
6-(difluoromethyl)-3-methyl-2-(trifluoromethoxy)pyridine-4-carbonitrile (PubChem CID 118839308) has the molecular formula C9H5F5N2O and a molecular weight of 252.14 g/mol. Its IUPAC name is 6-(difluoromethyl)-3-methyl-2-(trifluoromethoxy)pyridine-4-carbonitrile.
| Compound Name | 6-(difluoromethyl)-3-methyl-2-(trifluoromethoxy)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 118839308 |
| Molecular Formula | C9H5F5N2O |
| Molecular Weight | 252.14 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 6-(difluoromethyl)-3-methyl-2-(trifluoromethoxy)pyridine-4-carbonitrile |
| SMILES | Cc1c(C#N)cc(C(F)F)nc1OC(F)(F)F |
| InChI | InChI=1S/C9H5F5N2O/c1-4-5(3-15)2-6(7(10)11)16-8(4)17-9(12,13)14/h2,7H,1H3 |
| InChIKey | PCHYUIYUZISQQU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.14 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |