C7H6ClF2N3O — CID 118839727
4-amino-6-chloro-5-(difluoromethyl)pyridine-3-carboxamide (PubChem CID 118839727) has the molecular formula C7H6ClF2N3O and a molecular weight of 221.59 g/mol. Its IUPAC name is 4-amino-6-chloro-5-(difluoromethyl)pyridine-3-carboxamide.
| Compound Name | 4-amino-6-chloro-5-(difluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118839727 |
| Molecular Formula | C7H6ClF2N3O |
| Molecular Weight | 221.59 g/mol |
| Exact Mass | 221.02 |
| IUPAC Name | 4-amino-6-chloro-5-(difluoromethyl)pyridine-3-carboxamide |
| SMILES | NC(=O)c1cnc(Cl)c(C(F)F)c1N |
| InChI | InChI=1S/C7H6ClF2N3O/c8-5-3(6(9)10)4(11)2(1-13-5)7(12)14/h1,6H,(H2,11,13)(H2,12,14) |
| InChIKey | WEUXZKMKAICWHQ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.59 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|