C9H10F2N2O — CID 130101517
5-(difluoromethyl)-4,6-dimethylpyridine-3-carboxamide (PubChem CID 130101517) has the molecular formula C9H10F2N2O and a molecular weight of 200.19 g/mol. Its IUPAC name is 5-(difluoromethyl)-4,6-dimethylpyridine-3-carboxamide.
| Compound Name | 5-(difluoromethyl)-4,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 130101517 |
| Molecular Formula | C9H10F2N2O |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 5-(difluoromethyl)-4,6-dimethylpyridine-3-carboxamide |
| SMILES | Cc1ncc(C(N)=O)c(C)c1C(F)F |
| InChI | InChI=1S/C9H10F2N2O/c1-4-6(9(12)14)3-13-5(2)7(4)8(10)11/h3,8H,1-2H3,(H2,12,14) |
| InChIKey | LNIFYXBNDYLZKR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |