C8H7F2IN2O2 — CID 118846499
4-(difluoromethyl)-5-iodo-6-methoxypyridine-3-carboxamide (PubChem CID 118846499) has the molecular formula C8H7F2IN2O2 and a molecular weight of 328.06 g/mol. Its IUPAC name is 4-(difluoromethyl)-5-iodo-6-methoxypyridine-3-carboxamide.
| Compound Name | 4-(difluoromethyl)-5-iodo-6-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 118846499 |
| Molecular Formula | C8H7F2IN2O2 |
| Molecular Weight | 328.06 g/mol |
| Exact Mass | 327.95 |
| IUPAC Name | 4-(difluoromethyl)-5-iodo-6-methoxypyridine-3-carboxamide |
| SMILES | COc1ncc(C(N)=O)c(C(F)F)c1I |
| InChI | InChI=1S/C8H7F2IN2O2/c1-15-8-5(11)4(6(9)10)3(2-13-8)7(12)14/h2,6H,1H3,(H2,12,14) |
| InChIKey | GWZBAANCKKFATL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.06 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|